C21H40N2O7 — CID 163651282
[2-(3-methoxybutanoyloxymethyl)-2-[3-(methylamino)butanoyloxymethyl]butyl] 3-(methylamino)butanoate (PubChem CID 163651282) has the molecular formula C21H40N2O7 and a molecular weight of 432.56 g/mol. Its IUPAC name is [2-(3-methoxybutanoyloxymethyl)-2-[3-(methylamino)butanoyloxymethyl]butyl] 3-(methylamino)butanoate.
| Compound Name | [2-(3-methoxybutanoyloxymethyl)-2-[3-(methylamino)butanoyloxymethyl]butyl] 3-(methylamino)butanoate |
|---|---|
| PubChem CID | 163651282 |
| Molecular Formula | C21H40N2O7 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | [2-(3-methoxybutanoyloxymethyl)-2-[3-(methylamino)butanoyloxymethyl]butyl] 3-(methylamino)butanoate |
| SMILES | CCC(COC(=O)CC(C)NC)(COC(=O)CC(C)NC)COC(=O)CC(C)OC |
| InChI | InChI=1S/C21H40N2O7/c1-8-21(12-28-18(24)9-15(2)22-5,13-29-19(25)10-16(3)23-6)14-30-20(26)11-17(4)27-7/h15-17,22-23H,8-14H2,1-7H3 |
| InChIKey | IMLVZLUPAUTTBU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|