About [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate
[(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate (PubChem CID 171578964) has the molecular formula C14H24O6
and a molecular weight of 288.34 g/mol. Its IUPAC name is [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate.
Molecular Properties
| Compound Name | [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate |
| PubChem CID | 171578964 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate |
| SMILES | CO[C@H](C)CC(=O)O[C@H](C)CC(=O)O[C@@H](C)CC(C)=O |
| InChI | InChI=1S/C14H24O6/c1-9(15)6-11(3)19-14(17)8-12(4)20-13(16)7-10(2)18-5/h10-12H,6-8H2,1-5H3/t10-,11+,12-/m1/s1 |
| InChIKey | NRDVOUYHIMFUIU-GRYCIOLGSA-N |
| XLogP | 1.64 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate?
The IUPAC name of [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate (CID 171578964) is [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate.
What is the SMILES notation for [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate?
The canonical SMILES for [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate is CO[C@H](C)CC(=O)O[C@H](C)CC(=O)O[C@@H](C)CC(C)=O.
What is the InChIKey of [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate?
The InChIKey is NRDVOUYHIMFUIU-GRYCIOLGSA-N. The full InChI is InChI=1S/C14H24O6/c1-9(15)6-11(3)19-14(17)8-12(4)20-13(16)7-10(2)18-5/h10-12H,6-8H2,1-5H3/t10-,11+,12-/m1/s1.
What are the key properties of [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate?
[(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate has a molecular weight of 288.34 g/mol, XLogP of 1.64, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-oxo-4-[(2S)-4-oxopentan-2-yl]oxybutan-2-yl] (3R)-3-methoxybutanoate is sourced from PubChem (CID 171578964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).