About 1-acetyloxyethyl 3-methoxybutanoate
1-acetyloxyethyl 3-methoxybutanoate (PubChem CID 87922228) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-acetyloxyethyl 3-methoxybutanoate.
Molecular Properties
| Compound Name | 1-acetyloxyethyl 3-methoxybutanoate |
| PubChem CID | 87922228 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 1-acetyloxyethyl 3-methoxybutanoate |
| SMILES | COC(C)CC(=O)OC(C)OC(C)=O |
| InChI | InChI=1S/C9H16O5/c1-6(12-4)5-9(11)14-8(3)13-7(2)10/h6,8H,5H2,1-4H3 |
| InChIKey | SMUXQMBFZBGZOA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-acetyloxyethyl 3-methoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyloxyethyl 3-methoxybutanoate?
The IUPAC name of 1-acetyloxyethyl 3-methoxybutanoate (CID 87922228) is 1-acetyloxyethyl 3-methoxybutanoate.
What is the SMILES notation for 1-acetyloxyethyl 3-methoxybutanoate?
The canonical SMILES for 1-acetyloxyethyl 3-methoxybutanoate is COC(C)CC(=O)OC(C)OC(C)=O.
What is the InChIKey of 1-acetyloxyethyl 3-methoxybutanoate?
The InChIKey is SMUXQMBFZBGZOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O5/c1-6(12-4)5-9(11)14-8(3)13-7(2)10/h6,8H,5H2,1-4H3.
What are the key properties of 1-acetyloxyethyl 3-methoxybutanoate?
1-acetyloxyethyl 3-methoxybutanoate has a molecular weight of 204.22 g/mol, XLogP of 0.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyloxyethyl 3-methoxybutanoate is sourced from PubChem (CID 87922228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).