About 1-silyloxyethyl acetate
1-silyloxyethyl acetate (PubChem CID 174935938) has the molecular formula C4H10O3Si
and a molecular weight of 134.21 g/mol. Its IUPAC name is 1-silyloxyethyl acetate.
Molecular Properties
| Compound Name | 1-silyloxyethyl acetate |
| PubChem CID | 174935938 |
| Molecular Formula | C4H10O3Si |
| Molecular Weight | 134.21 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 1-silyloxyethyl acetate |
| SMILES | CC(=O)OC(C)O[SiH3] |
| InChI | InChI=1S/C4H10O3Si/c1-3(5)6-4(2)7-8/h4H,1-2,8H3 |
| InChIKey | YXEKETIERFFBNO-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.21 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-silyloxyethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-silyloxyethyl acetate?
The IUPAC name of 1-silyloxyethyl acetate (CID 174935938) is 1-silyloxyethyl acetate.
What is the SMILES notation for 1-silyloxyethyl acetate?
The canonical SMILES for 1-silyloxyethyl acetate is CC(=O)OC(C)O[SiH3].
What is the InChIKey of 1-silyloxyethyl acetate?
The InChIKey is YXEKETIERFFBNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O3Si/c1-3(5)6-4(2)7-8/h4H,1-2,8H3.
What are the key properties of 1-silyloxyethyl acetate?
1-silyloxyethyl acetate has a molecular weight of 134.21 g/mol, XLogP of -0.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-silyloxyethyl acetate is sourced from PubChem (CID 174935938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).