C15H28O5 — CID 158576596
1-acetyloxyethyl 2,2-dimethylpropanoate;3,3-dimethylbutan-2-one (PubChem CID 158576596) has the molecular formula C15H28O5 and a molecular weight of 288.38 g/mol. Its IUPAC name is 1-acetyloxyethyl 2,2-dimethylpropanoate;3,3-dimethylbutan-2-one.
| Compound Name | 1-acetyloxyethyl 2,2-dimethylpropanoate;3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 158576596 |
| Molecular Formula | C15H28O5 |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 1-acetyloxyethyl 2,2-dimethylpropanoate;3,3-dimethylbutan-2-one |
| SMILES | CC(=O)C(C)(C)C.CC(=O)OC(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C9H16O4.C6H12O/c1-6(10)12-7(2)13-8(11)9(3,4)5;1-5(7)6(2,3)4/h7H,1-5H3;1-4H3 |
| InChIKey | HSSSOOYMSKFLAU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|