About 1-(1,2-dichloroethoxy)ethyl acetate
1-(1,2-dichloroethoxy)ethyl acetate (PubChem CID 19766036) has the molecular formula C6H10Cl2O3
and a molecular weight of 201.05 g/mol. Its IUPAC name is 1-(1,2-dichloroethoxy)ethyl acetate.
Molecular Properties
| Compound Name | 1-(1,2-dichloroethoxy)ethyl acetate |
| PubChem CID | 19766036 |
| Molecular Formula | C6H10Cl2O3 |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 1-(1,2-dichloroethoxy)ethyl acetate |
| SMILES | CC(=O)OC(C)OC(Cl)CCl |
| InChI | InChI=1S/C6H10Cl2O3/c1-4(9)10-5(2)11-6(8)3-7/h5-6H,3H2,1-2H3 |
| InChIKey | OCPUXKMEQQCNFK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-dichloroethoxy)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-dichloroethoxy)ethyl acetate?
The IUPAC name of 1-(1,2-dichloroethoxy)ethyl acetate (CID 19766036) is 1-(1,2-dichloroethoxy)ethyl acetate.
What is the SMILES notation for 1-(1,2-dichloroethoxy)ethyl acetate?
The canonical SMILES for 1-(1,2-dichloroethoxy)ethyl acetate is CC(=O)OC(C)OC(Cl)CCl.
What is the InChIKey of 1-(1,2-dichloroethoxy)ethyl acetate?
The InChIKey is OCPUXKMEQQCNFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Cl2O3/c1-4(9)10-5(2)11-6(8)3-7/h5-6H,3H2,1-2H3.
What are the key properties of 1-(1,2-dichloroethoxy)ethyl acetate?
1-(1,2-dichloroethoxy)ethyl acetate has a molecular weight of 201.05 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-dichloroethoxy)ethyl acetate is sourced from PubChem (CID 19766036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).