C13H27N3O6 — CID 171636121
[2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)butyl] N-methylcarbamate;ethane (PubChem CID 171636121) has the molecular formula C13H27N3O6 and a molecular weight of 321.37 g/mol. Its IUPAC name is [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)butyl] N-methylcarbamate;ethane.
| Compound Name | [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)butyl] N-methylcarbamate;ethane |
|---|---|
| PubChem CID | 171636121 |
| Molecular Formula | C13H27N3O6 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)butyl] N-methylcarbamate;ethane |
| SMILES | CC.CCC(COC(N)=O)(COC(=O)NC)COC(=O)NC |
| InChI | InChI=1S/C11H21N3O6.C2H6/c1-4-11(5-18-8(12)15,6-19-9(16)13-2)7-20-10(17)14-3;1-2/h4-7H2,1-3H3,(H2,12,15)(H,13,16)(H,14,17);1-2H3 |
| InChIKey | USIPVZPDZFIMNQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|