C12H21N3O6 — CID 130427850
[2-(methylcarbamoyloxymethyl)-2-(methylidenecarbamoyloxymethyl)butyl] N-methylcarbamate (PubChem CID 130427850) has the molecular formula C12H21N3O6 and a molecular weight of 303.32 g/mol. Its IUPAC name is [2-(methylcarbamoyloxymethyl)-2-(methylidenecarbamoyloxymethyl)butyl] N-methylcarbamate.
| Compound Name | [2-(methylcarbamoyloxymethyl)-2-(methylidenecarbamoyloxymethyl)butyl] N-methylcarbamate |
|---|---|
| PubChem CID | 130427850 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | [2-(methylcarbamoyloxymethyl)-2-(methylidenecarbamoyloxymethyl)butyl] N-methylcarbamate |
| SMILES | C=NC(=O)OCC(CC)(COC(=O)NC)COC(=O)NC |
| InChI | InChI=1S/C12H21N3O6/c1-5-12(6-19-9(16)13-2,7-20-10(17)14-3)8-21-11(18)15-4/h2,5-8H2,1,3-4H3,(H,14,17)(H,15,18) |
| InChIKey | PWJFUHFKNHQZIA-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|