About methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate
methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate (PubChem CID 175278368) has the molecular formula C6H12N2O4S
and a molecular weight of 208.24 g/mol. Its IUPAC name is methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate.
Molecular Properties
| Compound Name | methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate |
| PubChem CID | 175278368 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate |
| SMILES | CNC(=O)OCSCOC(=O)NC |
| InChI | InChI=1S/C6H12N2O4S/c1-7-5(9)11-3-13-4-12-6(10)8-2/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| InChIKey | NIEFPHXLOFXUIV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate?
The IUPAC name of methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate (CID 175278368) is methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate.
What is the SMILES notation for methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate?
The canonical SMILES for methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate is CNC(=O)OCSCOC(=O)NC.
What is the InChIKey of methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate?
The InChIKey is NIEFPHXLOFXUIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4S/c1-7-5(9)11-3-13-4-12-6(10)8-2/h3-4H2,1-2H3,(H,7,9)(H,8,10).
What are the key properties of methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate?
methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate has a molecular weight of 208.24 g/mol, XLogP of 0.35, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamoyloxymethylsulfanylmethyl N-methylcarbamate is sourced from PubChem (CID 175278368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).