About iodomethyl N-methylcarbamate
iodomethyl N-methylcarbamate (PubChem CID 88927146) has the molecular formula C3H6INO2
and a molecular weight of 214.99 g/mol. Its IUPAC name is iodomethyl N-methylcarbamate.
Molecular Properties
| Compound Name | iodomethyl N-methylcarbamate |
| PubChem CID | 88927146 |
| Molecular Formula | C3H6INO2 |
| Molecular Weight | 214.99 g/mol |
| Exact Mass | 214.94 |
| IUPAC Name | iodomethyl N-methylcarbamate |
| SMILES | CNC(=O)OCI |
| InChI | InChI=1S/C3H6INO2/c1-5-3(6)7-2-4/h2H2,1H3,(H,5,6) |
| InChIKey | RLXIFBPBPQCBTB-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.99 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodomethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodomethyl N-methylcarbamate?
The IUPAC name of iodomethyl N-methylcarbamate (CID 88927146) is iodomethyl N-methylcarbamate.
What is the SMILES notation for iodomethyl N-methylcarbamate?
The canonical SMILES for iodomethyl N-methylcarbamate is CNC(=O)OCI.
What is the InChIKey of iodomethyl N-methylcarbamate?
The InChIKey is RLXIFBPBPQCBTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6INO2/c1-5-3(6)7-2-4/h2H2,1H3,(H,5,6).
What are the key properties of iodomethyl N-methylcarbamate?
iodomethyl N-methylcarbamate has a molecular weight of 214.99 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iodomethyl N-methylcarbamate is sourced from PubChem (CID 88927146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).