About aminosulfanyl N-methylcarbamate
aminosulfanyl N-methylcarbamate (PubChem CID 21435462) has the molecular formula C2H6N2O2S
and a molecular weight of 122.15 g/mol. Its IUPAC name is aminosulfanyl N-methylcarbamate.
Molecular Properties
| Compound Name | aminosulfanyl N-methylcarbamate |
| PubChem CID | 21435462 |
| Molecular Formula | C2H6N2O2S |
| Molecular Weight | 122.15 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | aminosulfanyl N-methylcarbamate |
| SMILES | CNC(=O)OSN |
| InChI | InChI=1S/C2H6N2O2S/c1-4-2(5)6-7-3/h3H2,1H3,(H,4,5) |
| InChIKey | APHZYEGZGSKAJT-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aminosulfanyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminosulfanyl N-methylcarbamate?
The IUPAC name of aminosulfanyl N-methylcarbamate (CID 21435462) is aminosulfanyl N-methylcarbamate.
What is the SMILES notation for aminosulfanyl N-methylcarbamate?
The canonical SMILES for aminosulfanyl N-methylcarbamate is CNC(=O)OSN.
What is the InChIKey of aminosulfanyl N-methylcarbamate?
The InChIKey is APHZYEGZGSKAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O2S/c1-4-2(5)6-7-3/h3H2,1H3,(H,4,5).
What are the key properties of aminosulfanyl N-methylcarbamate?
aminosulfanyl N-methylcarbamate has a molecular weight of 122.15 g/mol, XLogP of -0.14, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminosulfanyl N-methylcarbamate is sourced from PubChem (CID 21435462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).