C22H28Cl4O12 — CID 175337125
2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butyl 4-chloro-4-oxobutanoate;4-chloro-4-oxobutanoic acid (PubChem CID 175337125) has the molecular formula C22H28Cl4O12 and a molecular weight of 626.27 g/mol. Its IUPAC name is 2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butyl 4-chloro-4-oxobutanoate;4-chloro-4-oxobutanoic acid.
| Compound Name | 2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butyl 4-chloro-4-oxobutanoate;4-chloro-4-oxobutanoic acid |
|---|---|
| PubChem CID | 175337125 |
| Molecular Formula | C22H28Cl4O12 |
| Molecular Weight | 626.27 g/mol |
| Exact Mass | 624.03 |
| IUPAC Name | 2,2-bis[(4-chloro-4-oxobutanoyl)oxymethyl]butyl 4-chloro-4-oxobutanoate;4-chloro-4-oxobutanoic acid |
| SMILES | CCC(COC(=O)CCC(=O)Cl)(COC(=O)CCC(=O)Cl)COC(=O)CCC(=O)Cl.O=C(O)CCC(=O)Cl |
| InChI | InChI=1S/C18H23Cl3O9.C4H5ClO3/c1-2-18(9-28-15(25)6-3-12(19)22,10-29-16(26)7-4-13(20)23)11-30-17(27)8-5-14(21)24;5-3(6)1-2-4(7)8/h2-11H2,1H3;1-2H2,(H,7,8) |
| InChIKey | DFWXOZURICTTKR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 184.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.27 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|