C12H22O4 — CID 156630139
4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid (PubChem CID 156630139) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid.
| Compound Name | 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid |
|---|---|
| PubChem CID | 156630139 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid |
| SMILES | CC(C)(C)C(C)(C)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C12H22O4/c1-11(2,3)12(4,5)8-16-10(15)7-6-9(13)14/h6-8H2,1-5H3,(H,13,14) |
| InChIKey | MJTZOBCFOCJRCO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |