4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid

C12H22O4 — CID 156630139

IUPAC4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid
SMILESCC(C)(C)C(C)(C)COC(=O)CCC(=O)O
InChIInChI=1S/C12H22O4/c1-11(2,3)12(4,5)8-16-10(15)7-6-9(13)14/h6-8H2,1-5H3,(H,13,14)
InChIKeyMJTZOBCFOCJRCO-UHFFFAOYSA-N
MW230.30 g/mol
LogP2.47
Rot. Bonds5

About 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid

4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid (PubChem CID 156630139) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid.

Molecular Properties

Compound Name4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid
PubChem CID156630139
Molecular FormulaC12H22O4
Molecular Weight230.30 g/mol
Exact Mass230.15
IUPAC Name4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid
SMILESCC(C)(C)C(C)(C)COC(=O)CCC(=O)O
InChIInChI=1S/C12H22O4/c1-11(2,3)12(4,5)8-16-10(15)7-6-9(13)14/h6-8H2,1-5H3,(H,13,14)
InChIKeyMJTZOBCFOCJRCO-UHFFFAOYSA-N
XLogP2.47
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.30
LogP ≤ 52.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid?
The IUPAC name of 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid (CID 156630139) is 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid.
What is the SMILES notation for 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid?
The canonical SMILES for 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid is CC(C)(C)C(C)(C)COC(=O)CCC(=O)O.
What is the InChIKey of 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid?
The InChIKey is MJTZOBCFOCJRCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-11(2,3)12(4,5)8-16-10(15)7-6-9(13)14/h6-8H2,1-5H3,(H,13,14).
What are the key properties of 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid?
4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid has a molecular weight of 230.30 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-(2,2,3,3-tetramethylbutoxy)butanoic acid is sourced from PubChem (CID 156630139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).