C34H56Cl2O18 — CID 175108685
butanedioic acid;bis(4-O-tert-butyl 1-O-[3-(chloromethoxycarbonyloxy)-2,2-dimethylpropyl] butanedioate) (PubChem CID 175108685) has the molecular formula C34H56Cl2O18 and a molecular weight of 823.71 g/mol. Its IUPAC name is butanedioic acid;bis(4-O-tert-butyl 1-O-[3-(chloromethoxycarbonyloxy)-2,2-dimethylpropyl] butanedioate).
| Compound Name | butanedioic acid;bis(4-O-tert-butyl 1-O-[3-(chloromethoxycarbonyloxy)-2,2-dimethylpropyl] butanedioate) |
|---|---|
| PubChem CID | 175108685 |
| Molecular Formula | C34H56Cl2O18 |
| Molecular Weight | 823.71 g/mol |
| Exact Mass | 822.28 |
| IUPAC Name | butanedioic acid;bis(4-O-tert-butyl 1-O-[3-(chloromethoxycarbonyloxy)-2,2-dimethylpropyl] butanedioate) |
| SMILES | CC(C)(COC(=O)CCC(=O)OC(C)(C)C)COC(=O)OCCl.CC(C)(COC(=O)CCC(=O)OC(C)(C)C)COC(=O)OCCl.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C15H25ClO7.C4H6O4/c2*1-14(2,3)23-12(18)7-6-11(17)20-8-15(4,5)9-21-13(19)22-10-16;5-3(6)1-2-4(7)8/h2*6-10H2,1-5H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | YSMJGVUCMNRMGA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 250.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|