About acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid
acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 177324913) has the molecular formula C15H31NO5
and a molecular weight of 305.42 g/mol. Its IUPAC name is acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| PubChem CID | 177324913 |
| Molecular Formula | C15H31NO5 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | CC(C)(C)OC(=O)CCCC(=O)O.CC(N)=O.CCCC |
| InChI | InChI=1S/C9H16O4.C4H10.C2H5NO/c1-9(2,3)13-8(12)6-4-5-7(10)11;1-3-4-2;1-2(3)4/h4-6H2,1-3H3,(H,10,11);3-4H2,1-2H3;1H3,(H2,3,4) |
| InChIKey | HOUVEWFYZPULCV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid?
The IUPAC name of acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (CID 177324913) is acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
What is the SMILES notation for acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid?
The canonical SMILES for acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid is CC(C)(C)OC(=O)CCCC(=O)O.CC(N)=O.CCCC.
What is the InChIKey of acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid?
The InChIKey is HOUVEWFYZPULCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C4H10.C2H5NO/c1-9(2,3)13-8(12)6-4-5-7(10)11;1-3-4-2;1-2(3)4/h4-6H2,1-3H3,(H,10,11);3-4H2,1-2H3;1H3,(H2,3,4).
What are the key properties of acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid?
acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid has a molecular weight of 305.42 g/mol, XLogP of 2.88, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;butane;5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid is sourced from PubChem (CID 177324913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).