acetamide;pentanedioic acid

C7H13NO5 — CID 160895913

IUPACacetamide;pentanedioic acid
SMILESCC(N)=O.O=C(O)CCCC(=O)O
InChIInChI=1S/C5H8O4.C2H5NO/c6-4(7)2-1-3-5(8)9;1-2(3)4/h1-3H2,(H,6,7)(H,8,9);1H3,(H2,3,4)
InChIKeySOWHFXKHWLXSHW-UHFFFAOYSA-N
MW191.18 g/mol
LogP-0.18
Rot. Bonds4

About acetamide;pentanedioic acid

acetamide;pentanedioic acid (PubChem CID 160895913) has the molecular formula C7H13NO5 and a molecular weight of 191.18 g/mol. Its IUPAC name is acetamide;pentanedioic acid.

Molecular Properties

Compound Nameacetamide;pentanedioic acid
PubChem CID160895913
Molecular FormulaC7H13NO5
Molecular Weight191.18 g/mol
Exact Mass191.08
IUPAC Nameacetamide;pentanedioic acid
SMILESCC(N)=O.O=C(O)CCCC(=O)O
InChIInChI=1S/C5H8O4.C2H5NO/c6-4(7)2-1-3-5(8)9;1-2(3)4/h1-3H2,(H,6,7)(H,8,9);1H3,(H2,3,4)
InChIKeySOWHFXKHWLXSHW-UHFFFAOYSA-N
XLogP-0.18
TPSA117.69 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.18
LogP ≤ 5-0.18
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze acetamide;pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetamide;pentanedioic acid?
The IUPAC name of acetamide;pentanedioic acid (CID 160895913) is acetamide;pentanedioic acid.
What is the SMILES notation for acetamide;pentanedioic acid?
The canonical SMILES for acetamide;pentanedioic acid is CC(N)=O.O=C(O)CCCC(=O)O.
What is the InChIKey of acetamide;pentanedioic acid?
The InChIKey is SOWHFXKHWLXSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C2H5NO/c6-4(7)2-1-3-5(8)9;1-2(3)4/h1-3H2,(H,6,7)(H,8,9);1H3,(H2,3,4).
What are the key properties of acetamide;pentanedioic acid?
acetamide;pentanedioic acid has a molecular weight of 191.18 g/mol, XLogP of -0.18, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;pentanedioic acid is sourced from PubChem (CID 160895913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).