About acetamide;pentanedioic acid
acetamide;pentanedioic acid (PubChem CID 160895913) has the molecular formula C7H13NO5
and a molecular weight of 191.18 g/mol. Its IUPAC name is acetamide;pentanedioic acid.
Molecular Properties
| Compound Name | acetamide;pentanedioic acid |
| PubChem CID | 160895913 |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | acetamide;pentanedioic acid |
| SMILES | CC(N)=O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C5H8O4.C2H5NO/c6-4(7)2-1-3-5(8)9;1-2(3)4/h1-3H2,(H,6,7)(H,8,9);1H3,(H2,3,4) |
| InChIKey | SOWHFXKHWLXSHW-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetamide;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;pentanedioic acid?
The IUPAC name of acetamide;pentanedioic acid (CID 160895913) is acetamide;pentanedioic acid.
What is the SMILES notation for acetamide;pentanedioic acid?
The canonical SMILES for acetamide;pentanedioic acid is CC(N)=O.O=C(O)CCCC(=O)O.
What is the InChIKey of acetamide;pentanedioic acid?
The InChIKey is SOWHFXKHWLXSHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C2H5NO/c6-4(7)2-1-3-5(8)9;1-2(3)4/h1-3H2,(H,6,7)(H,8,9);1H3,(H2,3,4).
What are the key properties of acetamide;pentanedioic acid?
acetamide;pentanedioic acid has a molecular weight of 191.18 g/mol, XLogP of -0.18, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;pentanedioic acid is sourced from PubChem (CID 160895913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).