About azane;bis(pentanedioic acid)
azane;bis(pentanedioic acid) (PubChem CID 138524332) has the molecular formula C10H19NO8
and a molecular weight of 281.26 g/mol. Its IUPAC name is azane;bis(pentanedioic acid).
Molecular Properties
| Compound Name | azane;bis(pentanedioic acid) |
| PubChem CID | 138524332 |
| Molecular Formula | C10H19NO8 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | azane;bis(pentanedioic acid) |
| SMILES | N.O=C(O)CCCC(=O)O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C5H8O4.H3N/c2*6-4(7)2-1-3-5(8)9;/h2*1-3H2,(H,6,7)(H,8,9);1H3 |
| InChIKey | KYDJHVGTKBSTRR-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 184.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze azane;bis(pentanedioic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;bis(pentanedioic acid)?
The IUPAC name of azane;bis(pentanedioic acid) (CID 138524332) is azane;bis(pentanedioic acid).
What is the SMILES notation for azane;bis(pentanedioic acid)?
The canonical SMILES for azane;bis(pentanedioic acid) is N.O=C(O)CCCC(=O)O.O=C(O)CCCC(=O)O.
What is the InChIKey of azane;bis(pentanedioic acid)?
The InChIKey is KYDJHVGTKBSTRR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8O4.H3N/c2*6-4(7)2-1-3-5(8)9;/h2*1-3H2,(H,6,7)(H,8,9);1H3.
What are the key properties of azane;bis(pentanedioic acid)?
azane;bis(pentanedioic acid) has a molecular weight of 281.26 g/mol, XLogP of 0.81, 8 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;bis(pentanedioic acid) is sourced from PubChem (CID 138524332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).