C15H23ClO7 — CID 146293404
4-O-tert-butyl 1-O-[(1S,2R)-2-(chloromethoxycarbonyloxy)cyclopentyl] butanedioate (PubChem CID 146293404) has the molecular formula C15H23ClO7 and a molecular weight of 350.80 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[(1S,2R)-2-(chloromethoxycarbonyloxy)cyclopentyl] butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-[(1S,2R)-2-(chloromethoxycarbonyloxy)cyclopentyl] butanedioate |
|---|---|
| PubChem CID | 146293404 |
| Molecular Formula | C15H23ClO7 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-O-tert-butyl 1-O-[(1S,2R)-2-(chloromethoxycarbonyloxy)cyclopentyl] butanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)O[C@H]1CCC[C@H]1OC(=O)OCCl |
| InChI | InChI=1S/C15H23ClO7/c1-15(2,3)23-13(18)8-7-12(17)21-10-5-4-6-11(10)22-14(19)20-9-16/h10-11H,4-9H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | XLJRTWGYJGFYJX-WDEREUQCSA-N |
| XLogP | 2.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|