C8H10Cl2O7 — CID 102394469
[(3R,4S)-4-(chloromethoxycarbonyloxy)oxolan-3-yl] chloromethyl carbonate (PubChem CID 102394469) has the molecular formula C8H10Cl2O7 and a molecular weight of 289.07 g/mol. Its IUPAC name is [(3R,4S)-4-(chloromethoxycarbonyloxy)oxolan-3-yl] chloromethyl carbonate.
| Compound Name | [(3R,4S)-4-(chloromethoxycarbonyloxy)oxolan-3-yl] chloromethyl carbonate |
|---|---|
| PubChem CID | 102394469 |
| Molecular Formula | C8H10Cl2O7 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | [(3R,4S)-4-(chloromethoxycarbonyloxy)oxolan-3-yl] chloromethyl carbonate |
| SMILES | O=C(OCCl)O[C@H]1COC[C@H]1OC(=O)OCCl |
| InChI | InChI=1S/C8H10Cl2O7/c9-3-14-7(11)16-5-1-13-2-6(5)17-8(12)15-4-10/h5-6H,1-4H2/t5-,6+ |
| InChIKey | FNMDUDPAHDLCJX-OLQVQODUSA-N |
| XLogP | 1.45 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|