About (4-hydroxyoxolan-3-yl) 2-aminoacetate
(4-hydroxyoxolan-3-yl) 2-aminoacetate (PubChem CID 131172210) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is (4-hydroxyoxolan-3-yl) 2-aminoacetate.
Molecular Properties
| Compound Name | (4-hydroxyoxolan-3-yl) 2-aminoacetate |
| PubChem CID | 131172210 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | (4-hydroxyoxolan-3-yl) 2-aminoacetate |
| SMILES | NCC(=O)OC1COCC1O |
| InChI | InChI=1S/C6H11NO4/c7-1-6(9)11-5-3-10-2-4(5)8/h4-5,8H,1-3,7H2 |
| InChIKey | CDWDRAPBRNBLFU-UHFFFAOYSA-N |
| XLogP | -1.75 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-hydroxyoxolan-3-yl) 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyoxolan-3-yl) 2-aminoacetate?
The IUPAC name of (4-hydroxyoxolan-3-yl) 2-aminoacetate (CID 131172210) is (4-hydroxyoxolan-3-yl) 2-aminoacetate.
What is the SMILES notation for (4-hydroxyoxolan-3-yl) 2-aminoacetate?
The canonical SMILES for (4-hydroxyoxolan-3-yl) 2-aminoacetate is NCC(=O)OC1COCC1O.
What is the InChIKey of (4-hydroxyoxolan-3-yl) 2-aminoacetate?
The InChIKey is CDWDRAPBRNBLFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c7-1-6(9)11-5-3-10-2-4(5)8/h4-5,8H,1-3,7H2.
What are the key properties of (4-hydroxyoxolan-3-yl) 2-aminoacetate?
(4-hydroxyoxolan-3-yl) 2-aminoacetate has a molecular weight of 161.16 g/mol, XLogP of -1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyoxolan-3-yl) 2-aminoacetate is sourced from PubChem (CID 131172210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).