C8H14O5 — CID 101047051
(3R,4R)-4-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyoxolan-3-ol (PubChem CID 101047051) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (3R,4R)-4-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyoxolan-3-ol.
| Compound Name | (3R,4R)-4-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyoxolan-3-ol |
|---|---|
| PubChem CID | 101047051 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (3R,4R)-4-[(3S,4S)-4-hydroxyoxolan-3-yl]oxyoxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1O[C@H]1COC[C@@H]1O |
| InChI | InChI=1S/C8H14O5/c9-5-1-11-3-7(5)13-8-4-12-2-6(8)10/h5-10H,1-4H2/t5-,6+,7-,8+ |
| InChIKey | ZPVIGJUORCVDPM-KVFPUHGPSA-N |
| XLogP | -1.48 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |