C13H25NO3 — CID 114266661
4-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyoxolan-3-ol (PubChem CID 114266661) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyoxolan-3-ol.
| Compound Name | 4-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyoxolan-3-ol |
|---|---|
| PubChem CID | 114266661 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | 4-[1-(aminomethyl)-4,4-dimethylcyclohexyl]oxyoxolan-3-ol |
| SMILES | CC1(C)CCC(CN)(OC2COCC2O)CC1 |
| InChI | InChI=1S/C13H25NO3/c1-12(2)3-5-13(9-14,6-4-12)17-11-8-16-7-10(11)15/h10-11,15H,3-9,14H2,1-2H3 |
| InChIKey | QOIBCVGTQNGZRP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |