C5H10O3S — CID 167184845
(3R,4R)-4-methylsulfanyloxyoxolan-3-ol (PubChem CID 167184845) has the molecular formula C5H10O3S and a molecular weight of 150.20 g/mol. Its IUPAC name is (3R,4R)-4-methylsulfanyloxyoxolan-3-ol.
| Compound Name | (3R,4R)-4-methylsulfanyloxyoxolan-3-ol |
|---|---|
| PubChem CID | 167184845 |
| Molecular Formula | C5H10O3S |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | (3R,4R)-4-methylsulfanyloxyoxolan-3-ol |
| SMILES | CSO[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C5H10O3S/c1-9-8-5-3-7-2-4(5)6/h4-6H,2-3H2,1H3/t4-,5-/m1/s1 |
| InChIKey | XHIUJWXCUBOAEB-RFZPGFLSSA-N |
| XLogP | 0.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|