C8H14O4 — CID 11137612
[(3R,4S)-4-hydroxyoxolan-3-yl] 2-methylpropanoate (PubChem CID 11137612) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is [(3R,4S)-4-hydroxyoxolan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,4S)-4-hydroxyoxolan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 11137612 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | [(3R,4S)-4-hydroxyoxolan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H]1COC[C@@H]1O |
| InChI | InChI=1S/C8H14O4/c1-5(2)8(10)12-7-4-11-3-6(7)9/h5-7,9H,3-4H2,1-2H3/t6-,7+/m0/s1 |
| InChIKey | ZLQMHARRRYSYLM-NKWVEPMBSA-N |
| XLogP | -0.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |