C16H29NO3 — CID 106706973
tert-butyl 4-[(2,3-dimethylcyclohexyl)amino]-4-oxobutanoate (PubChem CID 106706973) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl 4-[(2,3-dimethylcyclohexyl)amino]-4-oxobutanoate.
| Compound Name | tert-butyl 4-[(2,3-dimethylcyclohexyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 106706973 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl 4-[(2,3-dimethylcyclohexyl)amino]-4-oxobutanoate |
| SMILES | CC1CCCC(NC(=O)CCC(=O)OC(C)(C)C)C1C |
| InChI | InChI=1S/C16H29NO3/c1-11-7-6-8-13(12(11)2)17-14(18)9-10-15(19)20-16(3,4)5/h11-13H,6-10H2,1-5H3,(H,17,18) |
| InChIKey | BZFDOOWTJRFPQP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |