C16H28N2O3 — CID 28587515
N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-morpholin-4-yl-4-oxobutanamide (PubChem CID 28587515) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-morpholin-4-yl-4-oxobutanamide.
| Compound Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-morpholin-4-yl-4-oxobutanamide |
|---|---|
| PubChem CID | 28587515 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-4-morpholin-4-yl-4-oxobutanamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H28N2O3/c1-12-4-3-5-14(13(12)2)17-15(19)6-7-16(20)18-8-10-21-11-9-18/h12-14H,3-11H2,1-2H3,(H,17,19)/t12-,13-,14-/m1/s1 |
| InChIKey | CZMTVKDHAVOWSA-MGPQQGTHSA-N |
| XLogP | 1.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |