C19H32O9 — CID 162501249
[2-[2-(2-methoxyethoxy)ethoxymethyl]-2-(3-oxobutanoyloxymethyl)butyl] 3-oxobutanoate (PubChem CID 162501249) has the molecular formula C19H32O9 and a molecular weight of 404.46 g/mol. Its IUPAC name is [2-[2-(2-methoxyethoxy)ethoxymethyl]-2-(3-oxobutanoyloxymethyl)butyl] 3-oxobutanoate.
| Compound Name | [2-[2-(2-methoxyethoxy)ethoxymethyl]-2-(3-oxobutanoyloxymethyl)butyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 162501249 |
| Molecular Formula | C19H32O9 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | [2-[2-(2-methoxyethoxy)ethoxymethyl]-2-(3-oxobutanoyloxymethyl)butyl] 3-oxobutanoate |
| SMILES | CCC(COCCOCCOC)(COC(=O)CC(C)=O)COC(=O)CC(C)=O |
| InChI | InChI=1S/C19H32O9/c1-5-19(13-27-17(22)10-15(2)20,14-28-18(23)11-16(3)21)12-26-9-8-25-7-6-24-4/h5-14H2,1-4H3 |
| InChIKey | NJVYKSPUYHODHF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|