C48H77N3O21 — CID 138712368
[2-(2-methoxyethoxymethyl)-2-(oxiran-2-ylmethoxymethyl)butyl] 3-[3,5-bis[3-[2,2-bis(oxiran-2-ylmethoxymethyl)butoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate (PubChem CID 138712368) has the molecular formula C48H77N3O21 and a molecular weight of 1032.14 g/mol. Its IUPAC name is [2-(2-methoxyethoxymethyl)-2-(oxiran-2-ylmethoxymethyl)butyl] 3-[3,5-bis[3-[2,2-bis(oxiran-2-ylmethoxymethyl)butoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate.
| Compound Name | [2-(2-methoxyethoxymethyl)-2-(oxiran-2-ylmethoxymethyl)butyl] 3-[3,5-bis[3-[2,2-bis(oxiran-2-ylmethoxymethyl)butoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
|---|---|
| PubChem CID | 138712368 |
| Molecular Formula | C48H77N3O21 |
| Molecular Weight | 1032.14 g/mol |
| Exact Mass | 1031.50 |
| IUPAC Name | [2-(2-methoxyethoxymethyl)-2-(oxiran-2-ylmethoxymethyl)butyl] 3-[3,5-bis[3-[2,2-bis(oxiran-2-ylmethoxymethyl)butoxy]-3-oxopropyl]-2,4,6-trioxo-1,3,5-triazinan-1-yl]propanoate |
| SMILES | CCC(COCCOC)(COCC1CO1)COC(=O)CCn1c(=O)n(CCC(=O)OCC(CC)(COCC2CO2)COCC2CO2)c(=O)n(CCC(=O)OCC(CC)(COCC2CO2)COCC2CO2)c1=O |
| InChI | InChI=1S/C48H77N3O21/c1-5-46(26-59-15-14-58-4,27-60-16-35-21-65-35)32-70-40(52)8-11-49-43(55)50(12-9-41(53)71-33-47(6-2,28-61-17-36-22-66-36)29-62-18-37-23-67-37)45(57)51(44(49)56)13-10-42(54)72-34-48(7-3,30-63-19-38-24-68-38)31-64-20-39-25-69-39/h35-39H,5-34H2,1-4H3 |
| InChIKey | FFMVYTGBLROWIA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 272.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1032.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|