C27H45NO9 — CID 19771509
2-[bis[2-(4,4-dimethyl-3-oxopentanoyl)oxyethyl]amino]ethyl 4,4-dimethyl-3-oxopentanoate (PubChem CID 19771509) has the molecular formula C27H45NO9 and a molecular weight of 527.66 g/mol. Its IUPAC name is 2-[bis[2-(4,4-dimethyl-3-oxopentanoyl)oxyethyl]amino]ethyl 4,4-dimethyl-3-oxopentanoate.
| Compound Name | 2-[bis[2-(4,4-dimethyl-3-oxopentanoyl)oxyethyl]amino]ethyl 4,4-dimethyl-3-oxopentanoate |
|---|---|
| PubChem CID | 19771509 |
| Molecular Formula | C27H45NO9 |
| Molecular Weight | 527.66 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 2-[bis[2-(4,4-dimethyl-3-oxopentanoyl)oxyethyl]amino]ethyl 4,4-dimethyl-3-oxopentanoate |
| SMILES | CC(C)(C)C(=O)CC(=O)OCCN(CCOC(=O)CC(=O)C(C)(C)C)CCOC(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C27H45NO9/c1-25(2,3)19(29)16-22(32)35-13-10-28(11-14-36-23(33)17-20(30)26(4,5)6)12-15-37-24(34)18-21(31)27(7,8)9/h10-18H2,1-9H3 |
| InChIKey | KOPPXEJMZDHVOM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 133.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.66 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|