C26H50O4 — CID 90137653
2-(3-tert-butyl-3,4,4-trimethylpentanoyl)oxyethyl 3-tert-butyl-3,4,4-trimethylpentanoate (PubChem CID 90137653) has the molecular formula C26H50O4 and a molecular weight of 426.68 g/mol. Its IUPAC name is 2-(3-tert-butyl-3,4,4-trimethylpentanoyl)oxyethyl 3-tert-butyl-3,4,4-trimethylpentanoate.
| Compound Name | 2-(3-tert-butyl-3,4,4-trimethylpentanoyl)oxyethyl 3-tert-butyl-3,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 90137653 |
| Molecular Formula | C26H50O4 |
| Molecular Weight | 426.68 g/mol |
| Exact Mass | 426.37 |
| IUPAC Name | 2-(3-tert-butyl-3,4,4-trimethylpentanoyl)oxyethyl 3-tert-butyl-3,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)C(C)(CC(=O)OCCOC(=O)CC(C)(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H50O4/c1-21(2,3)25(13,22(4,5)6)17-19(27)29-15-16-30-20(28)18-26(14,23(7,8)9)24(10,11)12/h15-18H2,1-14H3 |
| InChIKey | QNISTLPMYZHKDK-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.68 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|