About 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate
2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate (PubChem CID 162508602) has the molecular formula C9H18BrNO4
and a molecular weight of 284.15 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate |
| PubChem CID | 162508602 |
| Molecular Formula | C9H18BrNO4 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate |
| SMILES | CC(Br)C(=O)OCCN(CCO)CCO |
| InChI | InChI=1S/C9H18BrNO4/c1-8(10)9(14)15-7-4-11(2-5-12)3-6-13/h8,12-13H,2-7H2,1H3 |
| InChIKey | NWNHEXKBZQYZDG-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate (CID 162508602) is 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate is CC(Br)C(=O)OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate?
The InChIKey is NWNHEXKBZQYZDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18BrNO4/c1-8(10)9(14)15-7-4-11(2-5-12)3-6-13/h8,12-13H,2-7H2,1H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate?
2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate has a molecular weight of 284.15 g/mol, XLogP of -0.40, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethyl 2-bromopropanoate is sourced from PubChem (CID 162508602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).