C20H40O6 — CID 87468331
(E)-3,4-dimethylhex-3-ene;4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane (PubChem CID 87468331) has the molecular formula C20H40O6 and a molecular weight of 376.53 g/mol. Its IUPAC name is (E)-3,4-dimethylhex-3-ene;4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane.
| Compound Name | (E)-3,4-dimethylhex-3-ene;4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane |
|---|---|
| PubChem CID | 87468331 |
| Molecular Formula | C20H40O6 |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (E)-3,4-dimethylhex-3-ene;4-(2-hydroxyethoxy)-4-oxobutanoic acid;2-propan-2-yloxypropane |
| SMILES | CC(C)OC(C)C.CC/C(C)=C(\C)CC.O=C(O)CCC(=O)OCCO |
| InChI | InChI=1S/C8H16.C6H10O5.C6H14O/c1-5-7(3)8(4)6-2;7-3-4-11-6(10)2-1-5(8)9;1-5(2)7-6(3)4/h5-6H2,1-4H3;7H,1-4H2,(H,8,9);5-6H,1-4H3/b8-7+;; |
| InChIKey | BYQIOVDJZFVPEL-MIIBGCIDSA-N |
| XLogP | 4.35 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|