C21H36O16 — CID 175038974
bis(bis(2-hydroxyethyl) butanedioate);pentanedioic acid (PubChem CID 175038974) has the molecular formula C21H36O16 and a molecular weight of 544.50 g/mol. Its IUPAC name is bis(bis(2-hydroxyethyl) butanedioate);pentanedioic acid.
| Compound Name | bis(bis(2-hydroxyethyl) butanedioate);pentanedioic acid |
|---|---|
| PubChem CID | 175038974 |
| Molecular Formula | C21H36O16 |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.20 |
| IUPAC Name | bis(bis(2-hydroxyethyl) butanedioate);pentanedioic acid |
| SMILES | O=C(CCC(=O)OCCO)OCCO.O=C(CCC(=O)OCCO)OCCO.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/2C8H14O6.C5H8O4/c2*9-3-5-13-7(11)1-2-8(12)14-6-4-10;6-4(7)2-1-3-5(8)9/h2*9-10H,1-6H2;1-3H2,(H,6,7)(H,8,9) |
| InChIKey | DHKQIWHRHXNEFM-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 260.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|