C12H19NO7 — CID 175340488
5-(2-hydroxyethoxy)-5-oxopentanoic acid;piperidine-2,6-dione (PubChem CID 175340488) has the molecular formula C12H19NO7 and a molecular weight of 289.28 g/mol. Its IUPAC name is 5-(2-hydroxyethoxy)-5-oxopentanoic acid;piperidine-2,6-dione.
| Compound Name | 5-(2-hydroxyethoxy)-5-oxopentanoic acid;piperidine-2,6-dione |
|---|---|
| PubChem CID | 175340488 |
| Molecular Formula | C12H19NO7 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-(2-hydroxyethoxy)-5-oxopentanoic acid;piperidine-2,6-dione |
| SMILES | O=C(O)CCCC(=O)OCCO.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C7H12O5.C5H7NO2/c8-4-5-12-7(11)3-1-2-6(9)10;7-4-2-1-3-5(8)6-4/h8H,1-5H2,(H,9,10);1-3H2,(H,6,7,8) |
| InChIKey | CSXKXSJKFYEWBJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|