C10H15NO6 — CID 175379041
pentanedioic acid;piperidine-2,6-dione (PubChem CID 175379041) has the molecular formula C10H15NO6 and a molecular weight of 245.23 g/mol. Its IUPAC name is pentanedioic acid;piperidine-2,6-dione.
| Compound Name | pentanedioic acid;piperidine-2,6-dione |
|---|---|
| PubChem CID | 175379041 |
| Molecular Formula | C10H15NO6 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | pentanedioic acid;piperidine-2,6-dione |
| SMILES | O=C(O)CCCC(=O)O.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C5H7NO2.C5H8O4/c7-4-2-1-3-5(8)6-4;6-4(7)2-1-3-5(8)9/h1-3H2,(H,6,7,8);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | XVXJATDHNPMNEE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|