C10H12N2O8 — CID 175829217
oxalic acid;bis(pyrrolidine-2,5-dione) (PubChem CID 175829217) has the molecular formula C10H12N2O8 and a molecular weight of 288.21 g/mol. Its IUPAC name is oxalic acid;bis(pyrrolidine-2,5-dione).
| Compound Name | oxalic acid;bis(pyrrolidine-2,5-dione) |
|---|---|
| PubChem CID | 175829217 |
| Molecular Formula | C10H12N2O8 |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | oxalic acid;bis(pyrrolidine-2,5-dione) |
| SMILES | O=C(O)C(=O)O.O=C1CCC(=O)N1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/2C4H5NO2.C2H2O4/c2*6-3-1-2-4(7)5-3;3-1(4)2(5)6/h2*1-2H2,(H,5,6,7);(H,3,4)(H,5,6) |
| InChIKey | QMEIWKKSSNAACP-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 166.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|