imidazolidin-2-one;pentanedioic acid

C8H14N2O5 — CID 139045417

IUPACimidazolidin-2-one;pentanedioic acid
SMILESO=C(O)CCCC(=O)O.O=C1NCCN1
InChIInChI=1S/C5H8O4.C3H6N2O/c6-4(7)2-1-3-5(8)9;6-3-4-1-2-5-3/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H2,4,5,6)
InChIKeyFXBRJYNPSGEYGE-UHFFFAOYSA-N
MW218.21 g/mol
LogP-0.37
Rot. Bonds4

About imidazolidin-2-one;pentanedioic acid

imidazolidin-2-one;pentanedioic acid (PubChem CID 139045417) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is imidazolidin-2-one;pentanedioic acid.

Molecular Properties

Compound Nameimidazolidin-2-one;pentanedioic acid
PubChem CID139045417
Molecular FormulaC8H14N2O5
Molecular Weight218.21 g/mol
Exact Mass218.09
IUPAC Nameimidazolidin-2-one;pentanedioic acid
SMILESO=C(O)CCCC(=O)O.O=C1NCCN1
InChIInChI=1S/C5H8O4.C3H6N2O/c6-4(7)2-1-3-5(8)9;6-3-4-1-2-5-3/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H2,4,5,6)
InChIKeyFXBRJYNPSGEYGE-UHFFFAOYSA-N
XLogP-0.37
TPSA115.73 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 5-0.37
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze imidazolidin-2-one;pentanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of imidazolidin-2-one;pentanedioic acid?
The IUPAC name of imidazolidin-2-one;pentanedioic acid (CID 139045417) is imidazolidin-2-one;pentanedioic acid.
What is the SMILES notation for imidazolidin-2-one;pentanedioic acid?
The canonical SMILES for imidazolidin-2-one;pentanedioic acid is O=C(O)CCCC(=O)O.O=C1NCCN1.
What is the InChIKey of imidazolidin-2-one;pentanedioic acid?
The InChIKey is FXBRJYNPSGEYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C3H6N2O/c6-4(7)2-1-3-5(8)9;6-3-4-1-2-5-3/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H2,4,5,6).
What are the key properties of imidazolidin-2-one;pentanedioic acid?
imidazolidin-2-one;pentanedioic acid has a molecular weight of 218.21 g/mol, XLogP of -0.37, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidin-2-one;pentanedioic acid is sourced from PubChem (CID 139045417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).