About imidazolidin-2-one;pentanedioic acid
imidazolidin-2-one;pentanedioic acid (PubChem CID 139045417) has the molecular formula C8H14N2O5
and a molecular weight of 218.21 g/mol. Its IUPAC name is imidazolidin-2-one;pentanedioic acid.
Molecular Properties
| Compound Name | imidazolidin-2-one;pentanedioic acid |
| PubChem CID | 139045417 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | imidazolidin-2-one;pentanedioic acid |
| SMILES | O=C(O)CCCC(=O)O.O=C1NCCN1 |
| InChI | InChI=1S/C5H8O4.C3H6N2O/c6-4(7)2-1-3-5(8)9;6-3-4-1-2-5-3/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H2,4,5,6) |
| InChIKey | FXBRJYNPSGEYGE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazolidin-2-one;pentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidin-2-one;pentanedioic acid?
The IUPAC name of imidazolidin-2-one;pentanedioic acid (CID 139045417) is imidazolidin-2-one;pentanedioic acid.
What is the SMILES notation for imidazolidin-2-one;pentanedioic acid?
The canonical SMILES for imidazolidin-2-one;pentanedioic acid is O=C(O)CCCC(=O)O.O=C1NCCN1.
What is the InChIKey of imidazolidin-2-one;pentanedioic acid?
The InChIKey is FXBRJYNPSGEYGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O4.C3H6N2O/c6-4(7)2-1-3-5(8)9;6-3-4-1-2-5-3/h1-3H2,(H,6,7)(H,8,9);1-2H2,(H2,4,5,6).
What are the key properties of imidazolidin-2-one;pentanedioic acid?
imidazolidin-2-one;pentanedioic acid has a molecular weight of 218.21 g/mol, XLogP of -0.37, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidin-2-one;pentanedioic acid is sourced from PubChem (CID 139045417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).