C7H11Br2NO2 — CID 160540875
1,2-dibromoethane;piperidine-2,6-dione (PubChem CID 160540875) has the molecular formula C7H11Br2NO2 and a molecular weight of 300.98 g/mol. Its IUPAC name is 1,2-dibromoethane;piperidine-2,6-dione.
| Compound Name | 1,2-dibromoethane;piperidine-2,6-dione |
|---|---|
| PubChem CID | 160540875 |
| Molecular Formula | C7H11Br2NO2 |
| Molecular Weight | 300.98 g/mol |
| Exact Mass | 298.92 |
| IUPAC Name | 1,2-dibromoethane;piperidine-2,6-dione |
| SMILES | BrCCBr.O=C1CCCC(=O)N1 |
| InChI | InChI=1S/C5H7NO2.C2H4Br2/c7-4-2-1-3-5(8)6-4;3-1-2-4/h1-3H2,(H,6,7,8);1-2H2 |
| InChIKey | QWTNFDARCROSGE-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.98 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|