C8H15NO2 — CID 145404800
azepane-2,7-dione;ethane (PubChem CID 145404800) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is azepane-2,7-dione;ethane.
| Compound Name | azepane-2,7-dione;ethane |
|---|---|
| PubChem CID | 145404800 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | azepane-2,7-dione;ethane |
| SMILES | CC.O=C1CCCCC(=O)N1 |
| InChI | InChI=1S/C6H9NO2.C2H6/c8-5-3-1-2-4-6(9)7-5;1-2/h1-4H2,(H,7,8,9);1-2H3 |
| InChIKey | HDIGGQAJKAZXOG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|