C7H14N2O5 — CID 160784508
1,3-diazonane-2,4,9-trione;dihydrate (PubChem CID 160784508) has the molecular formula C7H14N2O5 and a molecular weight of 206.20 g/mol. Its IUPAC name is 1,3-diazonane-2,4,9-trione;dihydrate.
| Compound Name | 1,3-diazonane-2,4,9-trione;dihydrate |
|---|---|
| PubChem CID | 160784508 |
| Molecular Formula | C7H14N2O5 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1,3-diazonane-2,4,9-trione;dihydrate |
| SMILES | O.O.O=C1CCCCC(=O)NC(=O)N1 |
| InChI | InChI=1S/C7H10N2O3.2H2O/c10-5-3-1-2-4-6(11)9-7(12)8-5;;/h1-4H2,(H2,8,9,10,11,12);2*1H2 |
| InChIKey | AGBHUVURNQOQHV-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 138.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |