C10H13NO2 — CID 24974773
1,5,6,7,8,9-hexahydro-3-benzazepine-2,4-dione (PubChem CID 24974773) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1,5,6,7,8,9-hexahydro-3-benzazepine-2,4-dione.
| Compound Name | 1,5,6,7,8,9-hexahydro-3-benzazepine-2,4-dione |
|---|---|
| PubChem CID | 24974773 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1,5,6,7,8,9-hexahydro-3-benzazepine-2,4-dione |
| SMILES | O=C1CC2=C(CCCC2)CC(=O)N1 |
| InChI | InChI=1S/C10H13NO2/c12-9-5-7-3-1-2-4-8(7)6-10(13)11-9/h1-6H2,(H,11,12,13) |
| InChIKey | OZYRMVVANJMUCW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|