C14H24N4O4 — CID 10481144
1,4,10,13-tetrazacyclooctadecane-5,9,14,18-tetrone (PubChem CID 10481144) has the molecular formula C14H24N4O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1,4,10,13-tetrazacyclooctadecane-5,9,14,18-tetrone.
| Compound Name | 1,4,10,13-tetrazacyclooctadecane-5,9,14,18-tetrone |
|---|---|
| PubChem CID | 10481144 |
| Molecular Formula | C14H24N4O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1,4,10,13-tetrazacyclooctadecane-5,9,14,18-tetrone |
| SMILES | O=C1CCCC(=O)NCCNC(=O)CCCC(=O)NCCN1 |
| InChI | InChI=1S/C14H24N4O4/c19-11-3-1-4-12(20)16-8-10-18-14(22)6-2-5-13(21)17-9-7-15-11/h1-10H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | IKBYDUHVMZESQA-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |