C12H20N4O4 — CID 12581071
1,4,9,12-tetrazacyclohexadecane-5,8,13,16-tetrone (PubChem CID 12581071) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 1,4,9,12-tetrazacyclohexadecane-5,8,13,16-tetrone.
| Compound Name | 1,4,9,12-tetrazacyclohexadecane-5,8,13,16-tetrone |
|---|---|
| PubChem CID | 12581071 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1,4,9,12-tetrazacyclohexadecane-5,8,13,16-tetrone |
| SMILES | O=C1CCC(=O)NCCNC(=O)CCC(=O)NCCN1 |
| InChI | InChI=1S/C12H20N4O4/c17-9-1-2-10(18)14-7-8-16-12(20)4-3-11(19)15-6-5-13-9/h1-8H2,(H,13,17)(H,14,18)(H,15,19)(H,16,20) |
| InChIKey | AGSBJMJNGZARMK-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |