C13H20N2O6 — CID 594066
1,5-dioxa-10,13-diazacycloheptadecane-6,9,14,17-tetrone (PubChem CID 594066) has the molecular formula C13H20N2O6 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1,5-dioxa-10,13-diazacycloheptadecane-6,9,14,17-tetrone.
| Compound Name | 1,5-dioxa-10,13-diazacycloheptadecane-6,9,14,17-tetrone |
|---|---|
| PubChem CID | 594066 |
| Molecular Formula | C13H20N2O6 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1,5-dioxa-10,13-diazacycloheptadecane-6,9,14,17-tetrone |
| SMILES | O=C1CCC(=O)OCCCOC(=O)CCC(=O)NCCN1 |
| InChI | InChI=1S/C13H20N2O6/c16-10-2-4-12(18)20-8-1-9-21-13(19)5-3-11(17)15-7-6-14-10/h1-9H2,(H,14,16)(H,15,17) |
| InChIKey | PVSCMTGMQJMAFQ-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |