C13H24O5 — CID 87901031
ethene;6-(2-hydroxyethoxy)-6-oxohexanoic acid;prop-1-ene (PubChem CID 87901031) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is ethene;6-(2-hydroxyethoxy)-6-oxohexanoic acid;prop-1-ene.
| Compound Name | ethene;6-(2-hydroxyethoxy)-6-oxohexanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 87901031 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | ethene;6-(2-hydroxyethoxy)-6-oxohexanoic acid;prop-1-ene |
| SMILES | C=C.C=CC.O=C(O)CCCCC(=O)OCCO |
| InChI | InChI=1S/C8H14O5.C3H6.C2H4/c9-5-6-13-8(12)4-2-1-3-7(10)11;1-3-2;1-2/h9H,1-6H2,(H,10,11);3H,1H2,2H3;1-2H2 |
| InChIKey | YWUNOYWMVGVXBF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|