C12H18O8 — CID 174751438
4-[6-(2-hydroxyethoxy)-6-oxohexanoyl]oxy-4-oxobutanoic acid (PubChem CID 174751438) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is 4-[6-(2-hydroxyethoxy)-6-oxohexanoyl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[6-(2-hydroxyethoxy)-6-oxohexanoyl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174751438 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 4-[6-(2-hydroxyethoxy)-6-oxohexanoyl]oxy-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)OC(=O)CCCCC(=O)OCCO |
| InChI | InChI=1S/C12H18O8/c13-7-8-19-10(16)3-1-2-4-11(17)20-12(18)6-5-9(14)15/h13H,1-8H2,(H,14,15) |
| InChIKey | PPOKMKIWKLYUBH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|