C11H16O6 — CID 87223612
4-(3-hydroxy-5-methyl-4-oxohex-5-enoxy)-4-oxobutanoic acid (PubChem CID 87223612) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is 4-(3-hydroxy-5-methyl-4-oxohex-5-enoxy)-4-oxobutanoic acid.
| Compound Name | 4-(3-hydroxy-5-methyl-4-oxohex-5-enoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87223612 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 4-(3-hydroxy-5-methyl-4-oxohex-5-enoxy)-4-oxobutanoic acid |
| SMILES | C=C(C)C(=O)C(O)CCOC(=O)CCC(=O)O |
| InChI | InChI=1S/C11H16O6/c1-7(2)11(16)8(12)5-6-17-10(15)4-3-9(13)14/h8,12H,1,3-6H2,2H3,(H,13,14) |
| InChIKey | GHJFARXUBBZNLU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|