C10H14O6 — CID 57146164
4-(3-hydroxy-4-methyl-2-oxopent-4-enoxy)-4-oxobutanoic acid (PubChem CID 57146164) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methyl-2-oxopent-4-enoxy)-4-oxobutanoic acid.
| Compound Name | 4-(3-hydroxy-4-methyl-2-oxopent-4-enoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57146164 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-(3-hydroxy-4-methyl-2-oxopent-4-enoxy)-4-oxobutanoic acid |
| SMILES | C=C(C)C(O)C(=O)COC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H14O6/c1-6(2)10(15)7(11)5-16-9(14)4-3-8(12)13/h10,15H,1,3-5H2,2H3,(H,12,13) |
| InChIKey | LSBINJFBZAPAHT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|