C18H35NO3 — CID 20740956
3-[2,2-bis(prop-2-enoxymethyl)butoxy]-N-propylpropan-1-amine (PubChem CID 20740956) has the molecular formula C18H35NO3 and a molecular weight of 313.48 g/mol. Its IUPAC name is 3-[2,2-bis(prop-2-enoxymethyl)butoxy]-N-propylpropan-1-amine.
| Compound Name | 3-[2,2-bis(prop-2-enoxymethyl)butoxy]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 20740956 |
| Molecular Formula | C18H35NO3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | 3-[2,2-bis(prop-2-enoxymethyl)butoxy]-N-propylpropan-1-amine |
| SMILES | C=CCOCC(CC)(COCC=C)COCCCNCCC |
| InChI | InChI=1S/C18H35NO3/c1-5-10-19-11-9-14-22-17-18(8-4,15-20-12-6-2)16-21-13-7-3/h6-7,19H,2-3,5,8-17H2,1,4H3 |
| InChIKey | QRRNJIBDASJPPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|