C16H32F3NO — CID 62726032
2-ethyl-N-propyl-2-[3-(2,2,2-trifluoroethoxy)propyl]hexan-1-amine (PubChem CID 62726032) has the molecular formula C16H32F3NO and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-ethyl-N-propyl-2-[3-(2,2,2-trifluoroethoxy)propyl]hexan-1-amine.
| Compound Name | 2-ethyl-N-propyl-2-[3-(2,2,2-trifluoroethoxy)propyl]hexan-1-amine |
|---|---|
| PubChem CID | 62726032 |
| Molecular Formula | C16H32F3NO |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | 2-ethyl-N-propyl-2-[3-(2,2,2-trifluoroethoxy)propyl]hexan-1-amine |
| SMILES | CCCCC(CC)(CCCOCC(F)(F)F)CNCCC |
| InChI | InChI=1S/C16H32F3NO/c1-4-7-9-15(6-3,13-20-11-5-2)10-8-12-21-14-16(17,18)19/h20H,4-14H2,1-3H3 |
| InChIKey | KNJHQRHIMKFJGQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|